34950-82-8 Usage
Uses
Used in Pharmaceutical Industry:
7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, which includes a pyridine and oxazine ring along with a bromine atom, makes it a valuable component in the development of new drugs with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 7-Bromo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine serves as a key building block. It can be utilized to create a range of other organic compounds, potentially leading to the discovery of novel molecules with diverse applications in various industries, including but not limited to pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 34950-82-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,5 and 0 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 34950-82:
(7*3)+(6*4)+(5*9)+(4*5)+(3*0)+(2*8)+(1*2)=128
128 % 10 = 8
So 34950-82-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN2O/c8-5-3-6-7(10-4-5)9-1-2-11-6/h3-4H,1-2H2,(H,9,10)
