34970-18-8 Usage
Uses
Used in Pharmaceutical Research:
3,3-Dimethylcyclobutanecarboxylic acid is utilized as a building block in organic synthesis and pharmaceutical research. Its distinctive structure and properties contribute to its potential in the development of pharmaceutical drugs and other bioactive compounds.
Used in Organic Synthesis:
In the field of organic synthesis, 3,3-Dimethylcyclobutanecarboxylic acid serves as a valuable intermediate. It plays a crucial role in the production of various organic compounds, facilitating the synthesis of complex molecules.
Used in Chemical Production:
3,3-Dimethylcyclobutanecarboxylic acid is also considered in the chemical production industry, where it may be employed to create a range of products that leverage its unique chemical properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 34970-18-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,9,7 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 34970-18:
(7*3)+(6*4)+(5*9)+(4*7)+(3*0)+(2*1)+(1*8)=128
128 % 10 = 8
So 34970-18-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O2/c1-7(2)3-5(4-7)6(8)9/h5H,3-4H2,1-2H3,(H,8,9)
