350-67-4 Usage
Uses
Used in Electron Transfer Chemistry:
3,5-DICHLOROPHENYLDIAZONIUM TETRAFLUOROBORATE is used as a reactant for electron transfer chemistry, facilitating the transfer of electrons between molecules and promoting various chemical reactions.
Used in Microwave-Accelerated Cross-Coupling Reactions:
In this application, 3,5-DICHLOROPHENYLDIAZONIUM TETRAFLUOROBORATE is used as a reactant to enhance the rate of cross-coupling reactions under microwave irradiation, leading to faster and more efficient synthesis of complex organic molecules.
Used in Sandmeyer Bromination:
3,5-DICHLOROPHENYLDIAZONIUM TETRAFLUOROBORATE is used as a reactant in Sandmeyer bromination, a method for the preparation of bromobenzene derivatives. This process involves the conversion of diazonium salts to aryl halides, which are important intermediates in the synthesis of various organic compounds.
Used in Catalytic Thiocyanation:
In the presence of copper salts, 3,5-DICHLOROPHENYLDIAZONIUM TETRAFLUOROBORATE is used as a reactant for catalytic thiocyanation, a reaction that introduces a thiocyanate group (SCN-) into an organic molecule, leading to the formation of thiocyanate derivatives with potential applications in various industries.
Used in Electrochemical Reduction:
3,5-DICHLOROPHENYLDIAZONIUM TETRAFLUOROBORATE is used as a reactant in electrochemical reduction processes, where it can be reduced to form various products depending on the specific reaction conditions. This application allows for the synthesis of a wide range of organic compounds with potential uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 350-67-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,5 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 350-67:
(5*3)+(4*5)+(3*0)+(2*6)+(1*7)=54
54 % 10 = 4
So 350-67-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2N2.BF4/c7-4-1-5(8)3-6(2-4)10-9;2-1(3,4)5/h1-3H;/q+1;-1