350997-69-2 Usage
Uses
Used in Pharmaceutical Industry:
3-(3,4-DIMETHOXY-PHENYL)-1H-PYRAZOLE-4-CARBALDEHYDE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with unique therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(3,4-DIMETHOXY-PHENYL)-1H-PYRAZOLE-4-CARBALDEHYDE is utilized as a building block for the creation of agrochemicals, potentially enhancing crop protection and yield through the development of novel bioactive molecules.
Used in Medicinal Chemistry Research:
3-(3,4-DIMETHOXY-PHENYL)-1H-PYRAZOLE-4-CARBALDEHYDE is employed as a valuable intermediate in medicinal chemistry for the exploration of its potential in the development of new pharmacological agents, contributing to advancements in drug discovery and therapeutic innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 350997-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,0,9,9 and 7 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 350997-69:
(8*3)+(7*5)+(6*0)+(5*9)+(4*9)+(3*7)+(2*6)+(1*9)=182
182 % 10 = 2
So 350997-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O3/c1-16-10-4-3-8(5-11(10)17-2)12-9(7-15)6-13-14-12/h3-7H,1-2H3,(H,13,14)
