351002-93-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Ethynyl-1-fluoro-2-methylbenzene 97 is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the formation of 1,4-disubstituted 1,2,3-triazoles, which are important building blocks in the development of new drugs with potential applications in treating various diseases.
Used in Chemical Research:
In the field of chemical research, 4-Ethynyl-1-fluoro-2-methylbenzene 97 serves as a valuable compound for studying the reactivity and properties of ethynyl, fluoro, and methyl groups in different chemical reactions. This knowledge can be applied to develop new synthetic methods and improve existing ones, ultimately leading to the discovery of novel compounds with diverse applications.
Used in Material Science:
4-Ethynyl-1-fluoro-2-methylbenzene 97 can be utilized in the development of new materials with specific properties, such as improved stability, reactivity, or selectivity. By incorporating 4-ETHYNYL-1-FLUORO-2-METHYLBENZENE 97 into the molecular structure of various materials, researchers can potentially create new materials with enhanced performance in various applications, including catalysis, sensors, and energy storage devices.
Used in Organic Synthesis:
As a versatile building block, 4-Ethynyl-1-fluoro-2-methylbenzene 97 is used in organic synthesis to create a wide range of organic compounds with diverse structures and functionalities. 4-ETHYNYL-1-FLUORO-2-METHYLBENZENE 97's reactivity in CuAAC reactions makes it an attractive candidate for the synthesis of complex molecules, which can be further modified and functionalized to meet specific requirements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 351002-93-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,1,0,0 and 2 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 351002-93:
(8*3)+(7*5)+(6*1)+(5*0)+(4*0)+(3*2)+(2*9)+(1*3)=92
92 % 10 = 2
So 351002-93-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F/c1-3-8-4-5-9(10)7(2)6-8/h1,4-6H,2H3
