35116-41-7 Usage
Uses
Used in Organic Synthesis:
2-Methyl-3-oxobutanal Sodium Salt is used as a synthetic intermediate for the production of a wide range of organic compounds. Its application in organic synthesis is due to its ability to participate in various chemical reactions, such as condensation, reduction, and oxidation, which allow for the formation of diverse molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Methyl-3-oxobutanal Sodium Salt is used as a key component in the synthesis of various drugs and drug candidates. Its unique chemical properties enable the development of novel therapeutic agents with potential applications in treating a variety of medical conditions.
Used in Chemical Research:
2-Methyl-3-oxobutanal Sodium Salt is also utilized in chemical research as a model compound for studying reaction mechanisms and exploring new synthetic methodologies. Its reactivity and structural features make it an ideal candidate for investigating various chemical transformations and understanding the underlying principles governing these reactions.
Used in Flavor and Fragrance Industry:
Additionally, 2-Methyl-3-oxobutanal Sodium Salt finds application in the flavor and fragrance industry, where it is used as a starting material for the synthesis of various aroma compounds. Its ability to form complex molecular structures with distinct olfactory properties makes it a valuable asset in the creation of new and innovative fragrances and flavors.
Check Digit Verification of cas no
The CAS Registry Mumber 35116-41-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,1,1 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 35116-41:
(7*3)+(6*5)+(5*1)+(4*1)+(3*6)+(2*4)+(1*1)=87
87 % 10 = 7
So 35116-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H8O2.Na/c1-4(3-6)5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-;/rC5H7NaO2/c1-4(3-8-6)5(2)7/h3H,1-2H3/b4-3-