351457-97-1 Usage
General Description
5-Bromo-1,2,3,4-tetrahydro-[1,7]naphthyridine is a chemical compound with the molecular formula C12H11BrN2. It falls into the category of organic compounds known as naphthyridines and quinolones, which are polycyclic aromatic compounds containing a naphthyridine moiety. This specific compound consists of a naphthyridine nucleus partially saturated to form a tetrahydro- derivative and further substituted with a single bromine atom. Its physical and chemical properties and biological activities, if any, are not well-documented in the scientific literature. Typically, compounds of this nature might be explored for their potential utility in the development of therapeutic agents. However, further research and studies are needed to understand the potential usefulness and safety of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 351457-97-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,1,4,5 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 351457-97:
(8*3)+(7*5)+(6*1)+(5*4)+(4*5)+(3*7)+(2*9)+(1*7)=151
151 % 10 = 1
So 351457-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2/c9-7-4-10-5-8-6(7)2-1-3-11-8/h4-5,11H,1-3H2
