35186-69-7 Usage
Uses
Used in Pharmaceutical Industry:
7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is utilized as a key building block for the synthesis of various biologically active compounds. Its role in the development of potential drug candidates is significant due to its unique structure and properties, which can be leveraged to create new drugs with specific therapeutic effects.
Used in Antifungal Applications:
In the realm of antifungal research, 7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is studied for its potential to combat fungal infections. Its heterocyclic nature may contribute to the development of new antifungal agents that can address existing and emerging fungal resistance.
Used in Antiviral Applications:
7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is also being investigated for its antiviral properties, with the aim of developing new antiviral drugs. Its heterocyclic structure could provide a foundation for the creation of compounds that can inhibit viral replication or disrupt viral life cycles.
Used in Anticancer Applications:
7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is being explored for its potential as an anticancer agent. Its unique chemical properties may enable the development of compounds that can target cancer cells specifically, offering new treatment options for various types of cancer.
Used in Organic Synthesis:
Beyond its biological applications, 7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is also valuable in organic synthesis. Its heterocyclic structure can be modified to create a range of chemical compounds with diverse applications in various industries.
Used in Coordination Chemistry:
In coordination chemistry, 7-Amino-S-Triazolo(1,5-a)Pyrimidin-5(4H)-one is studied for its potential as a ligand. Its ability to form stable complexes with metal ions could lead to the development of new materials with applications in catalysis, sensing, and other areas of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 35186-69-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,1,8 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 35186-69:
(7*3)+(6*5)+(5*1)+(4*8)+(3*6)+(2*6)+(1*9)=127
127 % 10 = 7
So 35186-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5O/c6-3-1-4(11)9-5-7-2-8-10(3)5/h1-2H,6H2,(H,7,8,9,11)
35186-69-7Relevant academic research and scientific papers
Efficient one pot synthesis of triazolotriazine, pyrazolotriazine, triazole, isoxazole and pyrazole derivatives
Rady, Eman A. El
, p. 215 - 221 (2013/01/16)
3-(3,5-Dimethyl-1 H -pyrazol-1-yl)-3-oxopropanenitrile (1) was used as a starting material for synthesis of functionalized heterocyclic derivatives mentioned in the title.
