351893-52-2 Usage
General Description
5-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester is a chemical compound that possesses a specific molecular structure consisting of a Quinoline, which is a combination of a benzene and pyridine, and a carboxylic acid with an ethyl group. 5-CHLORO-4-HYDROXY-8-METHYLQUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER includes functional groups such as chloro, hydroxy, methyl, carboxylic acid, and ester. It is chlorinated and hydroxylated, suggesting its introduction in substitution reactions and the possibility of being a part of complex molecular structures. Its exact properties such as toxicity, reactivity, or uses are not explicitly listed; these tend to depend on the desired applications and the other compounds it may interact with in those contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 351893-52-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,1,8,9 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 351893-52:
(8*3)+(7*5)+(6*1)+(5*8)+(4*9)+(3*3)+(2*5)+(1*2)=162
162 % 10 = 2
So 351893-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H12ClNO3/c1-3-18-13(17)8-6-15-11-7(2)4-5-9(14)10(11)12(8)16/h4-6H,3H2,1-2H3,(H,15,16)
