351982-48-4 Usage
Uses
Used in Organic Synthesis:
6-PHENETHYLCARBAMOYL-CYCLOHEX-3-ENECARBOXYLIC ACID is used as a reagent in organic synthesis for its unique chemical properties and ability to form new compounds through various chemical reactions.
Used in Pharmaceutical Research:
6-PHENETHYLCARBAMOYL-CYCLOHEX-3-ENECARBOXYLIC ACID is used as a research compound in pharmaceutical research for its potential applications in the development of new drugs and therapies.
Used in Enzymatic Inhibition:
6-PHENETHYLCARBAMOYL-CYCLOHEX-3-ENECARBOXYLIC ACID is used as an inhibitor of certain enzymatic processes, which may contribute to its therapeutic properties in treating various medical conditions.
Used in Therapeutic Applications:
6-PHENETHYLCARBAMOYL-CYCLOHEX-3-ENECARBOXYLIC ACID is used as a potential therapeutic agent for the treatment of various medical conditions, although further research is needed to fully understand and harness its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 351982-48-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,1,9,8 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 351982-48:
(8*3)+(7*5)+(6*1)+(5*9)+(4*8)+(3*2)+(2*4)+(1*8)=164
164 % 10 = 4
So 351982-48-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO3/c18-15(13-8-4-5-9-14(13)16(19)20)17-11-10-12-6-2-1-3-7-12/h1-7,13-14H,8-11H2,(H,17,18)(H,19,20)/p-1/t13-,14-/m1/s1