352018-87-2 Usage
Uses
Used in Pharmaceutical Industry:
4-(5-BROMO-2-THIENYL)-2-METHYL-1,3-THIAZOLE is used as a pharmaceutical candidate for its potential antibacterial, antifungal, and antitumor properties. Thiazole derivatives, including 4-(5-BROMO-2-THIENYL)-2-METHYL-1,3-THIAZOLE, have been found to possess these biological activities, making it a promising agent for the development of new drugs to combat various diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(5-BROMO-2-THIENYL)-2-METHYL-1,3-THIAZOLE is utilized as an active ingredient in the development of pesticides and fungicides. Its potential antimicrobial properties can be harnessed to protect crops from bacterial and fungal infections, thereby increasing agricultural productivity.
Used in Organic Synthesis:
4-(5-BROMO-2-THIENYL)-2-METHYL-1,3-THIAZOLE is also used as a building block in organic synthesis. Its unique structure allows for the creation of diverse chemical compounds, which can be further explored for various applications in different industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 352018-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,0,1 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 352018-87:
(8*3)+(7*5)+(6*2)+(5*0)+(4*1)+(3*8)+(2*8)+(1*7)=122
122 % 10 = 2
So 352018-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrNS2/c1-5-10-6(4-11-5)7-2-3-8(9)12-7/h2-4H,1H3
