352018-88-3 Usage
Uses
Used in Organic Synthesis:
5-Phenyl-1,3-oxazole-4-methanol serves as a key intermediate in organic synthesis, facilitating the creation of a variety of complex organic molecules. Its presence of both phenyl and hydroxyl groups allows for multiple reaction pathways, enhancing the compound's utility in constructing diverse chemical entities.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Phenyl-1,3-oxazole-4-methanol is utilized as a building block for the synthesis of pharmaceutical compounds. Its structural features enable the design of molecules with potential therapeutic effects, contributing to the development of new drugs with improved pharmacological profiles.
Used in the Development of Biologically Active Substances:
5-Phenyl-1,3-oxazole-4-methanol's unique structure also makes it a candidate for the development of biologically active substances. The phenyl and hydroxyl groups provide opportunities for molecular modifications that can enhance biological activity, making it a promising component in the creation of substances with specific biological targets and applications.
Used in Pharmaceutical Industry:
5-Phenyl-1,3-oxazole-4-methanol is employed in the pharmaceutical industry as a precursor for the synthesis of drugs. Its chemical versatility allows for the production of a wide range of medicinal agents, potentially addressing various therapeutic areas and contributing to the advancement of healthcare solutions.
Used in Research and Development:
In research and development settings, 5-Phenyl-1,3-oxazole-4-methanol is used to explore new chemical reactions and investigate its potential in creating novel compounds with unique properties. This exploration aids in expanding the understanding of chemical and biological interactions, paving the way for innovative applications in various scientific disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 352018-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,0,1 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 352018-88:
(8*3)+(7*5)+(6*2)+(5*0)+(4*1)+(3*8)+(2*8)+(1*8)=123
123 % 10 = 3
So 352018-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2/c12-6-9-10(13-7-11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2
