352018-93-0 Usage
Uses
Used in Pharmaceutical Industry:
(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE is used as a building block for the synthesis of various organic molecules, particularly in the development of biologically active compounds and pharmaceutical intermediates. Its unique properties contribute to the creation of new drugs and therapeutic agents.
Used in Chemical Research:
In the realm of chemical research, (1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE serves as a key component in the synthesis of complex organic molecules, facilitating advancements in chemical science and technology.
Used in Agrochemical Production:
(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE is utilized as a reactant in the production of agrochemicals, playing a crucial role in the development of pesticides, herbicides, and other agricultural chemicals to improve crop protection and yield.
Used in Materials Science Applications:
(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE also finds application in materials science, where it is employed in the synthesis of novel materials with specific properties for various industrial uses, such as in the development of new polymers, coatings, and composites.
Check Digit Verification of cas no
The CAS Registry Mumber 352018-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,0,1 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 352018-93:
(8*3)+(7*5)+(6*2)+(5*0)+(4*1)+(3*8)+(2*9)+(1*3)=120
120 % 10 = 0
So 352018-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3/c1-5-7(4-8)6(2)10(3)9-5/h4,8H2,1-3H3
C:Corrosive;
