352018-93-0 Usage
General Description
(1,3,5-Trimethyl-1H-pyrazol-4-yl)methylamine is a chemical compound with the molecular formula C7H12N2. It is a clear, colorless liquid with a molecular weight of 124.18 g/mol. (1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE is commonly used in pharmaceutical and chemical research as a building block for the synthesis of various organic molecules. It is often employed in the synthesis of biologically active compounds and pharmaceutical intermediates. Additionally, it can also be used as a reactant in the production of agrochemicals and materials science applications. (1,3,5-Trimethyl-1H-pyrazol-4-yl)methylamine is considered to be a versatile and valuable reagent in the field of organic chemistry due to its unique structural and functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 352018-93-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,0,1 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 352018-93:
(8*3)+(7*5)+(6*2)+(5*0)+(4*1)+(3*8)+(2*9)+(1*3)=120
120 % 10 = 0
So 352018-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3/c1-5-7(4-8)6(2)10(3)9-5/h4,8H2,1-3H3
C:Corrosive;
