35202-25-6 Usage
General Description
5-(4-Chlorophenyl)pyrimidin-4-amine is a chemical compound with the molecular formula C11H8ClN3. It is a pyrimidine derivative with a 4-aminopyrimidine structure and a 4-chlorophenyl group attached to the 5-position. 5-(4-CHLOROPHENYL)PYRIMIDIN-4-AMINE has the potential for use in pharmaceutical and chemical research due to its unique structure and properties. It may have applications in the development of new drugs, agrochemicals, and materials. The 4-chlorophenyl group contributes to the compound's chemical reactivity and potential interactions with biological targets, making it a valuable building block for the synthesis of novel compounds with desired properties. Overall, 5-(4-Chlorophenyl)pyrimidin-4-amine is a versatile and important chemical that has potential applications in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 35202-25-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,0 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35202-25:
(7*3)+(6*5)+(5*2)+(4*0)+(3*2)+(2*2)+(1*5)=76
76 % 10 = 6
So 35202-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN3/c11-8-3-1-7(2-4-8)9-5-13-6-14-10(9)12/h1-6H,(H2,12,13,14)
