35204-44-5 Usage
Uses
Used in Organic Synthesis:
ETHYL 6-IODO-4-OXO-4H-CHROMENE-2-CARBOXYLATE is used as a building block in organic synthesis for the preparation of various pharmaceutical compounds. Its unique structure, including the iodine atom and the ester group, allows for versatile chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, ETHYL 6-IODO-4-OXO-4H-CHROMENE-2-CARBOXYLATE is utilized for its potential biological activity. The presence of the iodine atom and the carbonyl group may contribute to its interaction with biological targets, suggesting its use in the development of new drugs and therapeutic agents.
Used in Pharmaceutical Industry:
ETHYL 6-IODO-4-OXO-4H-CHROMENE-2-CARBOXYLATE is used as a key intermediate in the pharmaceutical industry for the synthesis of drugs with potential therapeutic applications. Its unique chemical properties facilitate the creation of novel drug candidates that can address unmet medical needs.
Used in Research and Development:
In the research and development sector, ETHYL 6-IODO-4-OXO-4H-CHROMENE-2-CARBOXYLATE is employed for studying its biological activity and exploring its potential as a precursor to new chemical entities. This research can lead to the discovery of new drugs and therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 35204-44-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,0 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 35204-44:
(7*3)+(6*5)+(5*2)+(4*0)+(3*4)+(2*4)+(1*4)=85
85 % 10 = 5
So 35204-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H9IO4/c1-2-16-12(15)11-6-9(14)8-5-7(13)3-4-10(8)17-11/h3-6H,2H2,1H3
