35210-50-5 Usage
General Description
2,6-bis[3-(4-azidophenyl)-2-propenylidene]-4-methylcyclohexan-1-one is a highly complex and specific chemical compound with a molecular formula of C24H22N6O. It contains azido, phenyl, and propenyl groups within its structure, and is classified as a cyclohexanone derivative. 2,6-bis[3-(4-azidophenyl)-2-propenylidene]-4-methylcyclohexan-1-one is often used in organic synthesis and chemical research due to its potential application in bioconjugation and photolabeling studies. The unique arrangement of functional groups in this chemical make it an interesting subject of study in various fields of chemistry and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 35210-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,1 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35210-50:
(7*3)+(6*5)+(5*2)+(4*1)+(3*0)+(2*5)+(1*0)=75
75 % 10 = 5
So 35210-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C25H22N6O/c1-18-16-21(6-2-4-19-8-12-23(13-9-19)28-30-26)25(32)22(17-18)7-3-5-20-10-14-24(15-11-20)29-31-27/h2-15,18H,16-17H2,1H3/b4-2+,5-3+,21-6-,22-7+