35246-87-8 Usage
Uses
Used in Pharmaceutical Industry:
5,7-Dichloro-3-hydrazono-1,3-dihydro-indol-2-one is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique reactivity and properties make it a valuable precursor in the development of new drugs and medicinal agents.
Used in Agrochemical Industry:
In the agrochemical industry, 5,7-Dichloro-3-hydrazono-1,3-dihydro-indol-2-one is utilized as a starting material for the production of various agrochemicals. Its potential applications in this field include the development of pesticides, herbicides, and other crop protection agents.
Used in Organic Synthesis:
5,7-Dichloro-3-hydrazono-1,3-dihydro-indol-2-one is used as a precursor in the synthesis of a wide range of organic compounds. Its unique structure and reactivity make it a versatile building block for the creation of new molecules with potential applications in various fields, such as materials science, chemical engineering, and more.
Used in Research and Development:
This chemical compound is also employed in research and development settings, where it can be used to explore new chemical reactions, investigate its properties, and develop innovative applications in various industries. Its unique characteristics make it an interesting subject for scientific studies and potential breakthroughs in chemical synthesis and compound development.
Check Digit Verification of cas no
The CAS Registry Mumber 35246-87-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,4 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35246-87:
(7*3)+(6*5)+(5*2)+(4*4)+(3*6)+(2*8)+(1*7)=118
118 % 10 = 8
So 35246-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Cl2N3O/c9-3-1-4-6(5(10)2-3)12-8(14)7(4)13-11/h1-2H,11H2,(H,12,13,14)