352525-65-6 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-3-FLUOROPHENYLZINC IODIDE 0.5M& is used as a key intermediate in the synthesis of various pharmaceuticals. Its ability to form carbon-carbon and carbon-heteroatom bonds makes it a valuable component in the development of new drugs with unique therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4-BROMO-3-FLUOROPHENYLZINC IODIDE 0.5M& is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity in cross-coupling reactions allows for the creation of novel compounds with improved efficacy and selectivity in controlling pests and weeds.
Used in Materials Science:
4-BROMO-3-FLUOROPHENYLZINC IODIDE 0.5M& is employed in the synthesis of advanced materials, including polymers, coatings, and composites. Its versatility in forming various chemical bonds enables the development of materials with enhanced properties, such as improved strength, durability, and resistance to environmental factors.
Used in Organic Chemistry Research:
As a versatile building block, 4-BROMO-3-FLUOROPHENYLZINC IODIDE 0.5M& is widely used in organic chemistry research for exploring new reaction pathways, developing novel synthetic methods, and discovering new compounds with potential applications in various fields. Its reactivity and compatibility with various reaction conditions make it a valuable tool for chemists in their pursuit of new discoveries.
Check Digit Verification of cas no
The CAS Registry Mumber 352525-65-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,2 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 352525-65:
(8*3)+(7*5)+(6*2)+(5*5)+(4*2)+(3*5)+(2*6)+(1*5)=136
136 % 10 = 6
So 352525-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrF.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h1,3-4H;1H;/q;;+1/p-1/rC6H3BrFIZn/c7-5-2-1-4(10-9)3-6(5)8/h1-3H
