352525-75-8 Usage
Main properties
1. Chemical compound with an organozinc reagent
2. Contains a bromide counterion
3. Used in organic synthesis
4. Introduces the 3-methoxy-(2R)-(+)-methyl-3-oxopropyl functional group
5. Used for formation of carbon-carbon bonds and ketones/alcohols
6. Important in the preparation of complex organic molecules
Specific content
1. Molecular formula: C5H10BrO2Zn
2. Molar mass: 248.36 g/mol
3. Chemical structure: CH3OCH(CH3)C(O)ZnBr (3-methoxy-(2R)-(+)-methyl-3-oxopropylzinc bromide)
4. Reagent used in various organic reactions
5. Applications in pharmaceuticals, agrochemicals, and materials science
Check Digit Verification of cas no
The CAS Registry Mumber 352525-75-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,2 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 352525-75:
(8*3)+(7*5)+(6*2)+(5*5)+(4*2)+(3*5)+(2*7)+(1*5)=138
138 % 10 = 8
So 352525-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H9O2.BrH.Zn/c1-4(2)5(6)7-3;;/h4H,1H2,2-3H3;1H;/q;;+1/p-1/t4-;;/m1../s1/rC5H9O2Zn.BrH/c1-4(3-8)5(6)7-2;/h4H,3H2,1-2H3;1H/q+1;/p-1/t4-;/m0./s1
