352530-44-0 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-2-FLUOROPHENYLZINC IODIDE is used as a synthetic reagent for the development of new pharmaceutical compounds. Its ability to form carbon-carbon bonds through cross-coupling reactions allows for the creation of complex molecular structures with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-BROMO-2-FLUOROPHENYLZINC IODIDE is utilized as a key component in the synthesis of novel agrochemicals. Its reactivity and selectivity contribute to the development of innovative compounds with improved efficacy and selectivity in crop protection and pest management.
Used in Material Science:
4-BROMO-2-FLUOROPHENYLZINC IODIDE is employed as a building block in the synthesis of advanced materials. Its role in forming carbon-carbon bonds through cross-coupling reactions facilitates the creation of new materials with unique properties, such as improved conductivity, stability, or specific interactions with other molecules.
Overall, 4-BROMO-2-FLUOROPHENYLZINC IODIDE's versatility and reactivity make it an indispensable tool for synthetic chemists in various industries, driving the development of new compounds and materials with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 352530-44-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 352530-44:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*0)+(2*4)+(1*4)=120
120 % 10 = 0
So 352530-44-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrF.HI.Zn/c7-5-2-1-3-6(8)4-5;;/h1-2,4H;1H;/q;;+1/p-1/rC6H3BrFIZn/c7-4-1-2-6(10-9)5(8)3-4/h1-3H
