352534-84-0 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Bromo-2-fluoro-2-isopropoxyphenylis utilized as a key intermediate in the synthesis of pharmaceuticals for its ability to impart specific biological activities to the final drug molecules. Its unique functional groups can be further modified or serve as a starting point for the development of new therapeutic agents.
Used in Agrochemical Production:
In the agrochemical industry, 3-Bromo-2-fluoro-2-isopropoxyphenylis employed as a precursor in the creation of various agrochemicals, such as pesticides and herbicides. Its incorporation can enhance the effectiveness of these products, contributing to improved crop protection and yield.
Used in Materials Science:
3-Bromo-2-fluoro-2-isopropoxyphenylhas been studied for its potential application in materials science, where its unique structure can be leveraged to develop new materials with specific properties. This can include the creation of polymers, coatings, or other materials with tailored characteristics for various industrial applications.
Used in Organic Synthesis:
As a versatile intermediate, 3-Bromo-2-fluoro-2-isopropoxyphenylis also used in organic synthesis for the preparation of a wide range of organic compounds. Its reactivity and functional group compatibility make it a valuable component in the synthesis of complex organic molecules for research and commercial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 352534-84-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 352534-84:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*4)+(2*8)+(1*4)=140
140 % 10 = 0
So 352534-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BBrFO3/c1-5(2)15-9-7(10(13)14)3-6(12)4-8(9)11/h3-5,13-14H,1-2H3
