352534-87-3 Usage
Uses
Used in Organic Synthesis:
5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is used as a reagent in organic synthesis for the preparation of various functionalized organic molecules. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable component in the synthesis of complex organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals. Its ability to form carbon-carbon bonds through Suzuki-Miyaura cross-coupling reactions enables the creation of diverse drug molecules with potential therapeutic applications.
Used in Agrochemical Industry:
5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is also utilized in the agrochemical industry as a building block for the development of new agrochemicals. Its reactivity in organic synthesis allows for the creation of molecules with potential applications in crop protection and pest control.
Used in Materials Science:
In the field of materials science, 5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is employed in the synthesis of functional materials with specific properties. Its versatility in forming carbon-carbon bonds contributes to the development of advanced materials for various applications, such as electronics, energy storage, and sensing technologies.
Overall, 5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is a versatile and valuable chemical compound with applications across multiple industries, including organic synthesis, pharmaceuticals, agrochemicals, and materials science. Its unique structure and reactivity make it an essential building block for the development of innovative and functional molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 352534-87-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 352534-87:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*4)+(2*8)+(1*7)=143
143 % 10 = 3
So 352534-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-6(2)14-9-4-3-7(11)5-8(9)10(12)13/h3-6,12-13H,1-2H3
