35279-80-2 Usage
General Description
[1,2,3,4-Tetrakis(methoxycarbonyl)-1,3-butadiene-1,4-diyl]palladium, also known as Bischler-Napieralski palladium complex, is a chemical compound that is commonly used in organic synthesis. It is a palladium catalyst that is used in various cross-coupling reactions to form carbon-carbon bonds, such as the Suzuki-Miyaura coupling and the Heck reaction. [1,2,3,4-TETRAKIS(METHOXYCARBONYL)-1,3-BUTADIENE-1,4-DIYL]PALLADIUM is known for its ability to efficiently catalyze the formation of complex organic molecules with high selectivity and yield. It has gained significant attention in the field of organic chemistry due to its versatility and effectiveness in forming important carbon-carbon bonds.
Check Digit Verification of cas no
The CAS Registry Mumber 35279-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,7 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35279-80:
(7*3)+(6*5)+(5*2)+(4*7)+(3*9)+(2*8)+(1*0)=132
132 % 10 = 2
So 35279-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12O8.Pd/c1-17-9(13)5-7(11(15)19-3)8(12(16)20-4)6-10(14)18-2;/h1-4H3;/rC12H12O8Pd/c1-17-9(13)5-6(10(14)18-2)8(12(16)20-4)21-7(5)11(15)19-3/h1-4H3