35279-80-2 Usage
Uses
Used in Pharmaceutical Industry:
[1,2,3,4-TETRAKIS(METHOXYCARBONYL)-1,3-BUTADIENE-1,4-DIYL]PALLADIUM is used as a catalyst in the synthesis of complex organic molecules for the development of new pharmaceutical compounds. Its ability to form carbon-carbon bonds with high selectivity and yield is crucial for creating molecules with specific therapeutic properties.
Used in Chemical Research:
In the field of chemical research, [1,2,3,4-TETRAKIS(METHOXYCARBONYL)-1,3-BUTADIENE-1,4-DIYL]PALLADIUM is utilized as a catalyst for various cross-coupling reactions, such as the Suzuki-Miyaura coupling and the Heck reaction. It enables the formation of carbon-carbon bonds in a controlled manner, facilitating the synthesis of novel organic compounds for further study and application.
Used in Material Science:
[1,2,3,4-TETRAKIS(METHOXYCARBONYL)-1,3-BUTADIENE-1,4-DIYL]PALLADIUM is employed as a catalyst in the synthesis of advanced materials, such as polymers and organic semiconductors. Its role in forming carbon-carbon bonds is essential for creating materials with specific properties, such as conductivity, stability, and reactivity, which are vital for various applications in material science.
Used in Environmental Chemistry:
In environmental chemistry, [1,2,3,4-TETRAKIS(METHOXYCARBONYL)-1,3-BUTADIENE-1,4-DIYL]PALLADIUM is used as a catalyst for the degradation of pollutants and the synthesis of environmentally friendly compounds. Its ability to catalyze carbon-carbon bond formation helps in the development of processes that reduce the environmental impact of chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 35279-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,7 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35279-80:
(7*3)+(6*5)+(5*2)+(4*7)+(3*9)+(2*8)+(1*0)=132
132 % 10 = 2
So 35279-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12O8.Pd/c1-17-9(13)5-7(11(15)19-3)8(12(16)20-4)6-10(14)18-2;/h1-4H3;/rC12H12O8Pd/c1-17-9(13)5-6(10(14)18-2)8(12(16)20-4)21-7(5)11(15)19-3/h1-4H3
