3528-49-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Benzyl-4-methyl-2H-pyrazol-3-ylamine is used as a building block in the pharmaceutical industry for the preparation of various drugs and biologically active molecules. Its unique structure and reactivity make it an essential component in the development of new medications and therapeutic agents.
Used in Organic Chemistry:
In the field of organic chemistry, 2-Benzyl-4-methyl-2H-pyrazol-3-ylamine is utilized as a key intermediate in the synthesis of complex organic compounds. Its presence in reactions can facilitate the formation of desired products, making it a crucial tool for chemists in advancing the synthesis of novel compounds with potential applications in various industries.
Used in Drug Discovery and Development:
2-BENZYL-4-METHYL-2H-PYRAZOL-3-YLAMINE's potential applications extend to drug discovery and development, where it can contribute to the creation of new chemical entities with therapeutic potential. Its versatility in chemical reactions allows for the exploration of various molecular modifications, which can lead to the discovery of innovative drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 3528-49-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,2 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3528-49:
(6*3)+(5*5)+(4*2)+(3*8)+(2*4)+(1*9)=92
92 % 10 = 2
So 3528-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3/c1-9-7-13-14(11(9)12)8-10-5-3-2-4-6-10/h2-7H,8,12H2,1H3
3528-49-2Relevant academic research and scientific papers
Aminopyrazoles. IV. Pyrazol-3- and 5-amines from 2,3-dihaloalkanenitriles or 3-Chloroacrylonitriles and Hydrazines
Ege, Guenter,Franz, Hermann
, p. 1267 - 1273 (2007/10/02)
2,3-Dihalopropanenitriles and substituted 3-chloropropenenitriles react with hydrazines in basic solution to form either pyrazol-3-amines 4 or pyrazol-5-amines 5 or a mixture of both isomers.
