35359-23-0 Usage
Description
[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is a heterocyclic chemical compound characterized by a triazoloquinoline ring system with a thiol group attached to the first position. This unique and complex structure endows the compound with interesting and valuable properties, making it a subject of interest for further research and development in various fields.
Uses
Used in Pharmaceutical Industry:
[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is used as a potential pharmaceutical agent due to its unique structure and properties. The presence of the triazoloquinoline ring system and the thiol group may contribute to its potential therapeutic applications, warranting further exploration and development in drug discovery and medicinal chemistry.
Used in Agrochemical Industry:
[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is used as a potential agrochemical compound, leveraging its unique structure and properties for applications in crop protection, pest control, or other agricultural settings. Its potential use in this industry could lead to the development of new and effective products for agricultural needs.
Used in Materials Science:
[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is used as a component in the development of new materials for various applications in materials science. [1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL's unique structure may offer novel properties that can be harnessed to create advanced materials with specific characteristics for use in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 35359-23-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,5 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 35359-23:
(7*3)+(6*5)+(5*3)+(4*5)+(3*9)+(2*2)+(1*3)=120
120 % 10 = 0
So 35359-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3S/c14-10-12-11-9-6-5-7-3-1-2-4-8(7)13(9)10/h1-6H,(H,12,14)