35368-76-4 Usage
Derivative of acetamide
It is a modified version of acetamide This means that 2-(4-bromo-2-methylphenoxy)acetamide is structurally related to acetamide, with some alterations in its chemical structure.
Bromine-substituted methylphenoxy group
A bromine atom replaces a hydrogen atom on the methylphenoxy group This substitution gives the compound its unique properties and reactivity.
Building block in organic synthesis
It is often used to create more complex molecules As a versatile chemical intermediate, 2-(4-bromo-2-methylphenoxy)acetamide can be used to synthesize a variety of more complex organic compounds.
Applications in pharmaceutical research
It may have potential uses in the development of new drugs The compound could be a valuable component in the design and synthesis of novel pharmaceuticals, potentially leading to new treatments and therapies.
Value in scientific and industrial research
Its properties and potential uses make it a valuable and versatile chemical Due to its unique structure and reactivity, 2-(4-bromo-2-methylphenoxy)acetamide is a sought-after compound in various research fields, including chemistry, biology, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 35368-76-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,6 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35368-76:
(7*3)+(6*5)+(5*3)+(4*6)+(3*8)+(2*7)+(1*6)=134
134 % 10 = 4
So 35368-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrNO2/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H2,11,12)
