35368-93-5 Usage
General Description
6-CHLORO-2-THIOPHEN-2-YL-IMIDAZO[1,2-A]PYRIDINE is a chemical compound with the molecular formula C9H5ClN4S. It is a heterocyclic aromatic compound that contains a chloro group and a thiophene group. The imidazo[1,2-a]pyridine structure of the compound makes it a potential candidate for use in pharmaceutical research and development. It may have applications in the synthesis of new drugs, particularly in the field of antiviral and anticancer medications. Additionally, its structure and properties make it a potentially useful building block in organic synthesis for the creation of other complex molecules. Overall, 6-CHLORO-2-THIOPHEN-2-YL-IMIDAZO[1,2-A]PYRIDINE has potential uses in medicinal chemistry and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 35368-93-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,6 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 35368-93:
(7*3)+(6*5)+(5*3)+(4*6)+(3*8)+(2*9)+(1*3)=135
135 % 10 = 5
So 35368-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClN2S/c12-8-3-4-11-13-9(7-14(11)6-8)10-2-1-5-15-10/h1-7H
35368-93-5Relevant articles and documents
A simple and efficient route to 2-arylimidazo[1,2-a]pyridines and zolimidine using automated grindstone chemistry
Das, Dharmendra,Bhutia, Zigmee T.,Panjikar, Padmini C.,Chatterjee, Amrita,Banerjee, Mainak
supporting information, p. 4099 - 4107 (2020/09/09)
A green and efficient mechanochemical method for the synthesis of a series of 2-arylimidazo[1,2-a]pyridines was developed using an electrical grinder. I2 catalyzed mechanochemical grinding facilitates the cyclocondensation reaction between various aryl methyl ketones and 2-aminopyridines to afford 2-arylimidazo[1,2-a]pyridines in good yields at ambient temperature. The method was successfully used for the gram-scale synthesis of a marketed drug, zolimidine. The noticeable advantages of this environmentally sustainable protocol include mild conditions, simple instrumentation, inexpensive catalyst, atom economy, short reaction time etc.
