35441-10-2 Usage
Uses
Used in Pharmaceutical Industry:
2,6-dihydroxy-3-cyanopyridine is used as a pharmaceutical intermediate for its potential antioxidant and anti-inflammatory properties. It is particularly valuable for the development of treatments targeting various medical conditions such as diabetes, cancer, and neurodegenerative diseases due to its therapeutic potential.
Used in Organic Synthesis:
In the field of organic synthesis, 2,6-dihydroxy-3-cyanopyridine serves as a building block for the creation of new chemical entities. Its unique structure allows for the development of novel compounds with potential applications in drug discovery, contributing to the advancement of pharmaceutical research.
Used in Agrochemical Industry:
2,6-dihydroxy-3-cyanopyridine also finds applications in the agrochemical industry, where its diverse pharmacological properties can be harnessed for the development of new products, potentially enhancing crop protection and management strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 35441-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,4,4 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35441-10:
(7*3)+(6*5)+(5*4)+(4*4)+(3*1)+(2*1)+(1*0)=92
92 % 10 = 2
So 35441-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N2O2/c7-3-4-1-2-5(9)8-6(4)10/h1-2H,(H2,8,9,10)
