354548-08-6 Usage
General Description
Methyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound with the molecular formula C8H6BrN3O2. It is a derivative of imidazo[1,2-a]pyridine, a heterocyclic compound with potential pharmaceutical applications. This specific compound is a methyl ester with a bromine substituent at the 6 position. Imidazo[1,2-a]pyridine derivatives have been studied for their biological activities, including their potential as antiviral, antibacterial, and anticancer agents. The 6-bromoimidazo[1,2-a]pyridine-2-carboxylate may have potential applications in medicinal chemistry and drug development, but further research and testing are needed to understand its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 354548-08-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,4,5,4 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 354548-08:
(8*3)+(7*5)+(6*4)+(5*5)+(4*4)+(3*8)+(2*0)+(1*8)=156
156 % 10 = 6
So 354548-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)7-5-12-4-6(10)2-3-8(12)11-7/h2-5H,1H3
