354552-07-1 Usage
Uses
Used in Pharmaceutical Industry:
(1-Furan-2-yl-3-methyl-but-3-enyl)-phenyl-amine is used as a reactant in the synthetic preparation of tetrahydroisoindolo[2,1-a]quinolinecarboxylic acids. These acids are important intermediates in the development of pharmaceutical compounds, particularly those with potential applications in the treatment of various diseases and disorders. (1-FURAN-2-YL-3-METHYL-BUT-3-ENYL)-PHENYL-AMINE's ability to participate in Diels-Alder cycloaddition reactions with maleic anhydride and subsequent ring-opening intramolecular cyclization of azaoxatricyclodecenes makes it a valuable building block in the synthesis of complex drug molecules.
Used in Chemical Research:
In addition to its applications in the pharmaceutical industry, (1-Furan-2-yl-3-methyl-but-3-enyl)-phenyl-amine is also used in chemical research for the development of new synthetic methods and the exploration of novel chemical reactions. Its unique structure and reactivity make it an interesting candidate for studying various organic reactions, such as cycloadditions, rearrangements, and functional group transformations. This research can lead to the discovery of new synthetic pathways and the development of more efficient methods for the preparation of complex organic molecules.
Used in Material Science:
(1-FURAN-2-YL-3-METHYL-BUT-3-ENYL)-PHENYL-AMINE's unique structure and reactivity also make it a potential candidate for the development of new materials with specific properties. For example, its ability to form stable bonds with other molecules can be exploited to create new polymers, coatings, or other materials with tailored properties for various applications, such as electronics, aerospace, or automotive industries.
Check Digit Verification of cas no
The CAS Registry Mumber 354552-07-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,4,5,5 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 354552-07:
(8*3)+(7*5)+(6*4)+(5*5)+(4*5)+(3*2)+(2*0)+(1*7)=141
141 % 10 = 1
So 354552-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c1-12(2)11-14(15-9-6-10-17-15)16-13-7-4-3-5-8-13/h3-10,14,16H,1,11H2,2H3/t14-/m1/s1
354552-07-1Relevant academic research and scientific papers
New synthetic approach to substituted isoindolo[2,1-a]quinoline carboxylic acids via intramolecular Diels-Alder reaction of 4-(N-furyl-2)-4- arylaminobutenes-1 with maleic anhydride
Zubkov, Fedor I.,Boltukhina, Ekaterina V.,Turchin, Konstantin F.,Borisov, Roman S.,Varlamov, Alexey V.
, p. 4099 - 4113 (2007/10/03)
Acylation of substituted 4-(furyl-2)-4-arylaminobut-1-enes with maleic anhydride provided 2-allyl-6-carboxy-4-oxo-3-aza-10-oxatricyclo[5.2.1.0 1,5]dec-8-enes in high yield under mild reaction conditions. The Diels-Alder adducts are formed via an initial amide formation followed by a stereoselective intramolecular [4+2] exo-cycloaddition reaction. Treatment of the tricyclic compounds with phosphoric acid at high temperatures (70-120°C) promoted cyclic ether opening, intramolecular cyclization and aromatization to give the corresponding tetracyclic compounds, 5,6,6a,11-tetrahydro-10- carboxyisoindolo[2,1-a]quinolines, in moderate yields. The influence of the acid and the reaction temperature on the cyclization reactions are also discussed.
