3552-16-7 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
MANA is utilized as a key intermediate in the synthesis of various pharmaceutical compounds due to its reactive functional groups. Its presence in drug development can contribute to the creation of novel therapeutic agents, particularly those targeting specific biological pathways or mechanisms.
Used in the Development of New Materials:
The unique structure of MANA suggests that it may have applications in the development of innovative materials with specialized properties. These materials could be tailored for use in various industries, including but not limited to, coatings, adhesives, or even in the formulation of advanced composites.
Used in Organic Synthesis:
As a derivative of acrylic acid with additional functional groups, MANA serves as a versatile building block in organic synthesis. It can be incorporated into complex organic molecules, potentially leading to the discovery of new chemical entities with diverse applications.
Further research is essential to explore the full spectrum of potential uses and properties of (E)-3-[2-(Methyl-aci-nitro)acetylamino]acrylic acid, ensuring that its integration into various applications is both effective and safe.
Check Digit Verification of cas no
The CAS Registry Mumber 3552-16-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,5 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3552-16:
(6*3)+(5*5)+(4*5)+(3*2)+(2*1)+(1*6)=77
77 % 10 = 7
So 3552-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O5/c1-13-8(12)4-5(9)7-3-2-6(10)11/h2-4H,1H3,(H,7,9)(H,10,11)/b3-2+,8-4+
