355382-48-8 Usage
Uses
Used in Medicinal Chemistry:
(2,3-DIMETHOXY-BENZYL)-(4-FLUORO-BENZYL)-AMINE is used as a compound of interest in medicinal chemistry for its unique structure and potential biological activities. Its distinct benzyl groups may contribute to its interactions with biological targets, offering possibilities for the development of new therapeutic agents.
Used in Pharmaceutical Research:
In pharmaceutical research, (2,3-DIMETHOXY-BENZYL)-(4-FLUORO-BENZYL)-AMINE may be utilized to explore its potential as a lead compound for drug development. The presence of methoxy and fluorine substituents on the benzyl groups could provide specific binding affinities or modulate biological activity, which can be further investigated for the creation of novel pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 355382-48-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,5,3,8 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 355382-48:
(8*3)+(7*5)+(6*5)+(5*3)+(4*8)+(3*2)+(2*4)+(1*8)=158
158 % 10 = 8
So 355382-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H18FNO2/c1-19-15-5-3-4-13(16(15)20-2)11-18-10-12-6-8-14(17)9-7-12/h3-9,18H,10-11H2,1-2H3
