35576-05-7 Usage
Bicyclic heterocyclic compound
Derived from oxazolo[3,4-c]oxazol The compound is based on a bicyclic structure, which includes both oxazole and thiazole rings, making it a heterocyclic compound with different elements in the rings.
Laurate group attachment
The compound consists of a laurate group (C11H23COO-) attached to the oxazolo[3,4-c]oxazol-7a(7H)-ylmethyl moiety The laurate group, a long-chain fatty acid, is connected to the oxazolo[3,4-c]oxazol core structure, potentially influencing its physical and chemical properties.
Potential applications
Pharmaceutical, agricultural, and industrial sectors Due to its unique structure and properties, 1H,3H,5H-oxazolo[3,4-c]oxazol-7a(7H)-ylmethyl laurate may have various applications in different fields, such as pharmaceuticals for drug development, agriculture for pest control, and industry for chemical synthesis.
Further research needed
To fully understand properties and potential uses As with many chemical compounds, additional research and testing are required to explore the compound's properties, applications, and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 35576-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,5,7 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35576-05:
(7*3)+(6*5)+(5*5)+(4*7)+(3*6)+(2*0)+(1*5)=127
127 % 10 = 7
So 35576-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H33NO4/c1-2-3-4-5-6-7-8-9-10-11-17(20)23-14-18-12-21-15-19(18)16-22-13-18/h2-16H2,1H3