356092-30-3 Usage
Uses
Used in Pharmaceutical Industry:
[2-(1 H-INDOL-3-YL)-ETHYL]-(2-METHYL-BENZYL)-AMINE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the formation of diverse lactams, which are important building blocks in the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, [2-(1 H-INDOL-3-YL)-ETHYL]-(2-METHYL-BENZYL)-AMINE serves as a versatile starting material for the preparation of a wide range of organic compounds. Its reactivity and functional groups enable chemists to carry out various chemical reactions, leading to the formation of new compounds with potential applications in various industries.
Used in the Preparation of Structurally Diverse Lactams:
[2-(1 H-INDOL-3-YL)-ETHYL]-(2-METHYL-BENZYL)-AMINE is used in the preparation of structurally diverse lactams. Lactams are cyclic amide compounds that have a wide range of applications in the pharmaceutical industry, including the development of antibiotics, antidepressants, and other therapeutic agents. The unique structure of [2-(1 H-INDOL-3-YL)-ETHYL]-(2-METHYL-BENZYL)-AMINE allows for the synthesis of various lactam derivatives with different properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 356092-30-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,6,0,9 and 2 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 356092-30:
(8*3)+(7*5)+(6*6)+(5*0)+(4*9)+(3*2)+(2*3)+(1*0)=143
143 % 10 = 3
So 356092-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2/c1-14-6-2-3-7-15(14)12-19-11-10-16-13-20-18-9-5-4-8-17(16)18/h2-9,13,19-20H,10-12H2,1H3
