35619-39-7 Usage
General Description
D-4-Aminophenylglycine is a chemical compound classified as an amino acid derivative. It consists of a phenyl ring with an attached amino group and a glycine moiety. It is commonly used in the pharmaceutical industry as a precursor molecule in the synthesis of various pharmaceutical drugs. D-4-Aminophenylglycine is also utilized in the development of new drug candidates due to its potential therapeutic properties. Additionally, it has been studied for its role in inhibiting enzyme activity and as an antioxidant. Overall, D-4-Aminophenylglycine plays a significant role in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 35619-39-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,6,1 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 35619-39:
(7*3)+(6*5)+(5*6)+(4*1)+(3*9)+(2*3)+(1*9)=127
127 % 10 = 7
So 35619-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c9-6-1-3-7(4-2-6)10-5-8(11)12/h1-4,10H,5,9H2,(H,11,12)
