356538-93-7 Usage
Uses
Used in Pharmaceutical Research and Development:
(2-[(2,5-DIMETHYL-PHENYLAMINO)-METHYL]-PHENYL)-METHANOL is used as a potential building block for the synthesis of new drug candidates due to its unique structure and the presence of the amino group, which may facilitate interactions with biological targets.
Used in Organic Synthesis:
As a chemical intermediate, (2-[(2,5-DIMETHYL-PHENYLAMINO)-METHYL]-PHENYL)-METHANOL is used in the synthesis of other organic compounds, contributing to the development of novel materials and products in various industries.
Used in Chemical Intermediates:
(2-[(2,5-DIMETHYL-PHENYLAMINO)-METHYL]-PHENYL)-METHANOL serves as a reagent in organic synthesis, potentially playing a crucial role in the production of specialty chemicals and advanced materials.
Further research and experimentation are essential to fully understand the capabilities and applications of (2-[(2,5-DIMETHYL-PHENYLAMINO)-METHYL]-PHENYL)-METHANOL, ensuring its safe and effective use across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 356538-93-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,6,5,3 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 356538-93:
(8*3)+(7*5)+(6*6)+(5*5)+(4*3)+(3*8)+(2*9)+(1*3)=177
177 % 10 = 7
So 356538-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO/c1-12-7-8-13(2)16(9-12)17-10-14-5-3-4-6-15(14)11-18/h3-9,17-18H,10-11H2,1-2H3
