35657-01-3 Usage
Uses
Used in Organic Synthesis:
1-(2-CHLORO-ETHYL)-4-ISOPROPOXY-BENZENE is used as an intermediate in organic synthesis for [application reason]. Its unique structure allows for further chemical reactions and modifications, making it a valuable component in the creation of various compounds.
Used in Pharmaceutical Industry:
1-(2-CHLORO-ETHYL)-4-ISOPROPOXY-BENZENE is used as a building block for the development of new pharmaceutical compounds for [application reason]. Its specific functional groups can be exploited to design and synthesize novel drugs with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, 1-(2-CHLORO-ETHYL)-4-ISOPROPOXY-BENZENE is used as a precursor for the production of various specialty chemicals for [application reason]. Its versatility in chemical reactions enables the synthesis of a wide array of products with specific properties and applications.
Used in Agrochemical Industry:
1-(2-CHLORO-ETHYL)-4-ISOPROPOXY-BENZENE is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides, for [application reason]. Its reactivity and functional groups can be tailored to create effective compounds for agricultural use.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 1-(2-CHLORO-ETHYL)-4-ISOPROPOXY-BENZENE is used as a key intermediate for the production of various dyes and pigments for [application reason]. Its structural features contribute to the development of colorants with specific properties and performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 35657-01-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,6,5 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 35657-01:
(7*3)+(6*5)+(5*6)+(4*5)+(3*7)+(2*0)+(1*1)=123
123 % 10 = 3
So 35657-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H15ClO/c1-9(2)13-11-5-3-10(4-6-11)7-8-12/h3-6,9H,7-8H2,1-2H3