357263-44-6 Usage
Description
7-(benzyloxy)-1H-pyrrolo[3,2-b]pyridine is a chemical compound with a molecular formula C15H12N2O. It belongs to the class of pyrrolopyridine compounds and contains a pyrrolo[3,2-b]pyridine core with a benzyloxy group attached to it. 7-(benzyloxy)-1H-pyrrolo[3,2-b]pyridine has potential applications in the field of medicinal chemistry and drug discovery due to its ability to modulate biological pathways and interact with specific targets in the body. Its unique structure and properties make it of interest for research in the development of new pharmaceuticals and biologically active molecules.
Uses
Used in Medicinal Chemistry:
7-(benzyloxy)-1H-pyrrolo[3,2-b]pyridine is used as a chemical intermediate for the synthesis of various pharmaceuticals and biologically active molecules. Its unique structure allows it to modulate biological pathways and interact with specific targets in the body, making it a promising candidate for drug discovery and development.
Used in Drug Discovery:
7-(benzyloxy)-1H-pyrrolo[3,2-b]pyridine is used as a lead compound in the identification and optimization of new drug candidates. Its ability to modulate biological pathways and interact with specific targets in the body makes it a valuable tool in the search for novel therapeutic agents.
Used in Research:
7-(benzyloxy)-1H-pyrrolo[3,2-b]pyridine is used as a research tool to study the structure-activity relationships of pyrrolopyridine compounds and their potential applications in medicinal chemistry. Its unique properties and interactions with biological targets provide valuable insights into the development of new pharmaceuticals and biologically active molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 357263-44-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,7,2,6 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 357263-44:
(8*3)+(7*5)+(6*7)+(5*2)+(4*6)+(3*3)+(2*4)+(1*4)=156
156 % 10 = 6
So 357263-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O/c1-2-4-11(5-3-1)10-17-13-7-9-15-12-6-8-16-14(12)13/h1-9,16H,10H2
357263-44-6Relevant articles and documents
A general method for the preparation of 4-and 6-azaindoles
Zhang, Zhongxing,Yang, Zhong,Meanwell, Nicholas A.,Kadow, John F.,Wang, Tao
, p. 2345 - 2347 (2007/10/03)
Nitropyridines reacted with an excess of vinyl Grignard reagent to produce 4- or 6-azaindoles. Improved yields were obtained when a halogen atom was present at the position α to the nitrogen atom in the pyridine ring.