357420-38-3 Usage
Uses
Used in Pharmaceutical Industry:
2-[(2,5-DIMETHYL-FURAN-3-CARBONYL)-AMINO]-BENZOIC ACID is used as a potential candidate for the development of new pharmaceuticals due to its unique structural features, including the presence of a furan-3-carbonyl and amino groups. These functional groups may contribute to pharmacological activities, and further research may be conducted to explore its potential applications in drug discovery and development.
Used in Research Applications:
2-[(2,5-DIMETHYL-FURAN-3-CARBONYL)-AMINO]-BENZOIC ACID is used as a research compound for studying its chemical properties and potential interactions with biological systems. Its unique structure may provide insights into the development of new therapeutic agents or as a tool in understanding the mechanisms of action of existing drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 357420-38-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,7,4,2 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 357420-38:
(8*3)+(7*5)+(6*7)+(5*4)+(4*2)+(3*0)+(2*3)+(1*8)=143
143 % 10 = 3
So 357420-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO4/c1-8-7-11(9(2)19-8)13(16)15-12-6-4-3-5-10(12)14(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18)/p-1
