357915-04-9 Usage
Uses
Used in Chemical and Material Science:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used as a solvent for various chemical reactions due to its unique properties. It provides a stable and efficient medium for reactions to occur, enhancing the overall process.
Used in Battery Technology:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used as an electrolyte in batteries, contributing to their performance and stability. Its ionic nature allows for efficient charge transfer, improving the battery's energy storage capacity and longevity.
Used in Organic Synthesis:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used as a catalyst in organic synthesis reactions. Its ability to stabilize reactive intermediates and facilitate certain transformations makes it a valuable component in the synthesis of complex organic molecules.
Used in Gas Separation:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used in gas separation processes, particularly for the separation of CO2 from other gases. Its selective interaction with CO2 molecules makes it a promising candidate for applications in carbon capture and storage.
Used in Lubrication:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used as a lubricant in various industrial applications. Its low volatility and high thermal stability contribute to its effectiveness in reducing friction and wear in mechanical systems.
Used in CO2 Capture:
1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate is used as a CO2 capture agent, playing a crucial role in mitigating greenhouse gas emissions. Its ability to selectively bind with CO2 molecules allows for efficient capture and separation from other gases, making it a valuable tool in environmental protection.
It is important to handle 1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate with caution and follow safety protocols due to its potential toxicity and environmental impact. Proper handling and disposal are essential to ensure the safety of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 357915-04-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,7,9,1 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 357915-04:
(8*3)+(7*5)+(6*7)+(5*9)+(4*1)+(3*5)+(2*0)+(1*4)=169
169 % 10 = 9
So 357915-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H22N2.F6P/c1-3-4-5-6-7-8-13-10-9-12(2)11-13;1-7(2,3,4,5)6/h9-10H,3-8,11H2,1-2H3;/q;-1/p+1
