35891-72-6 Usage
General Description
2-amino-4-methoxy-3-butenoic acid is a chemical compound with the molecular formula C6H11NO3. It is an amino acid derivative that contains an amino group, a methoxy group, and a butenoic acid group. 2-amino-4-methoxy-3-butenoic acid is not naturally occurring, but it can be synthesized in the laboratory. It has potential applications in organic synthesis and pharmaceutical research due to its unique structure. The compound may have properties that make it suitable for use in the development of new drugs or as a building block in the synthesis of other organic compounds. Its specific uses and properties are still being investigated, but it holds promise for various applications in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 35891-72-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,8,9 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 35891-72:
(7*3)+(6*5)+(5*8)+(4*9)+(3*1)+(2*7)+(1*2)=146
146 % 10 = 6
So 35891-72-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO3/c1-9-3-2-4(6)5(7)8/h2-4H,6H2,1H3,(H,7,8)/b3-2+/t4-/m0/s1
