35926-15-9 Usage
General Description
(4-hydroxyphenyl) 3-pyridyl ketone, also known as PHDK, is a chemical compound with the molecular formula C11H9NO2. It is a yellow crystalline powder that is commonly used as a reagent in organic synthesis and pharmaceutical research. PHDK is known for its ability to act as a chelating ligand with metal ions, and it is often used in coordination chemistry studies. Additionally, PHDK has been investigated for its potential antioxidant and anti-inflammatory properties, making it a compound of interest in the development of new drugs for various medical applications. Its unique chemical structure and versatile reactivity make PHDK an important compound in the field of organic chemistry and pharmaceutical science.
Check Digit Verification of cas no
The CAS Registry Mumber 35926-15-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,2 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35926-15:
(7*3)+(6*5)+(5*9)+(4*2)+(3*6)+(2*1)+(1*5)=129
129 % 10 = 9
So 35926-15-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO2/c14-11-5-3-9(4-6-11)12(15)10-2-1-7-13-8-10/h1-8,14H
35926-15-9Relevant articles and documents
N-(3-pyridylalkyl)sulfonamide compounds which have useful pharmaceutical activity
-
, (2008/06/13)
Illustrative examples of the N-(3-pyridylalkyl)sulfonamide derivative are represented by the following formulae [II] and [III]: STR1 The derivatives are available for a thromboxane A2 production inhibitor, a thromboxane A2 antagonist, a prostaglandin H2 antagonist, an anti-thrombus agent, a thrombus-preventing agent and an anti-allergy agent.
