35957-14-3 Usage
Uses
Used in Pharmaceutical Research:
4-HYDROXY-BENZO[H]QUINOLINE-3-CARBOXYLIC ACID is used as a research compound for its potential as an anticancer agent, given its unique structure and pharmacological properties that may contribute to the development of new cancer therapies.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-HYDROXY-BENZO[H]QUINOLINE-3-CARBOXYLIC ACID is utilized as a key intermediate in the synthesis of various pharmaceuticals, leveraging its chemical reactivity and functional groups to create novel drug candidates.
Used in Organic Synthesis:
4-HYDROXY-BENZO[H]QUINOLINE-3-CARBOXYLIC ACID is employed as a versatile building block in organic synthesis, allowing for the creation of a wide range of chemical compounds with potential applications in various industries.
Used in Neurodegenerative Disease Research:
4-HYDROXY-BENZO[H]QUINOLINE-3-CARBOXYLIC ACID is studied for its potential as a therapeutic agent for neurodegenerative diseases, due to its ability to interact with biological targets and potentially mitigate the progression of such conditions.
Used in Drug Discovery:
As an important chemical for drug discovery, 4-HYDROXY-BENZO[H]QUINOLINE-3-CARBOXYLIC ACID is used to explore its potential in developing new pharmaceuticals with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 35957-14-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,5 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 35957-14:
(7*3)+(6*5)+(5*9)+(4*5)+(3*7)+(2*1)+(1*4)=143
143 % 10 = 3
So 35957-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H9NO3/c16-13-10-6-5-8-3-1-2-4-9(8)12(10)15-7-11(13)14(17)18/h1-7H,(H,15,16)(H,17,18)
