35966-16-6 Usage
General Description
8-Chloro-4-hydroxyquinoline-3-carboxylic acid is a chemical compound with the molecular formula C10H6ClNO3. It is a derivative of quinoline and is notable for containing a hydroxy and carboxylic acid group on its structure. 8-Chloro-4-hydroxyquinoline-3-carboxylic acid is used as an intermediate for the synthesis of various pharmaceuticals, particularly as a building block for the production of anti-bacterial and anti-inflammatory drugs. Additionally, it has been studied for its potential anti-cancer properties and as a tool in chemical biology research. The chemical's structure and properties make it a valuable component in medicinal and scientific applications, making it a focus of ongoing research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 35966-16-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,6 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35966-16:
(7*3)+(6*5)+(5*9)+(4*6)+(3*6)+(2*1)+(1*6)=146
146 % 10 = 6
So 35966-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNO3/c11-7-3-1-2-5-8(7)12-4-6(9(5)13)10(14)15/h1-4H,(H,12,13)(H,14,15)