35966-16-6 Usage
Uses
Used in Pharmaceutical Industry:
8-Chloro-4-hydroxyquinoline-3-carboxylic acid is used as an intermediate for the synthesis of various pharmaceuticals, particularly as a building block for the production of anti-bacterial and anti-inflammatory drugs. Its unique structure allows for the development of new and effective medications to combat bacterial infections and inflammation.
Used in Anti-cancer Research:
8-Chloro-4-hydroxyquinoline-3-carboxylic acid has been studied for its potential anti-cancer properties. Its ability to interact with biological systems and modulate cellular processes makes it a promising candidate for the development of new cancer therapies. Further research is needed to fully understand its potential and optimize its use in cancer treatment.
Used in Chemical Biology Research:
As a chemical compound with unique structural features, 8-Chloro-4-hydroxyquinoline-3-carboxylic acid serves as a valuable tool in chemical biology research. It can be used to probe and understand the interactions between small molecules and biological targets, contributing to the discovery of new biological insights and the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 35966-16-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,6 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35966-16:
(7*3)+(6*5)+(5*9)+(4*6)+(3*6)+(2*1)+(1*6)=146
146 % 10 = 6
So 35966-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNO3/c11-7-3-1-2-5-8(7)12-4-6(9(5)13)10(14)15/h1-4H,(H,12,13)(H,14,15)
