35973-17-2 Usage
Uses
Used in Pharmaceutical Industry:
8-Bromo-4-Hydroxyquinoline-3-Carboxylic Acid is used as a potential active pharmaceutical ingredient for its potential antioxidant and anticancer activities. Its unique structure allows for versatile chemistry, making it a candidate for the development of new medicines.
Used in Chemical Industry:
8-Bromo-4-Hydroxyquinoline-3-Carboxylic Acid is used as a chemical intermediate in the synthesis of various products, such as dyes and flavoring agents, due to its versatile chemistry.
Used in Research and Development:
8-Bromo-4-Hydroxyquinoline-3-Carboxylic Acid is used as a subject of study in scientific research to explore its potential properties and applications, including its possible antioxidant and anticancer effects. Further research is necessary to fully understand its capabilities and potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 35973-17-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,7 and 3 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35973-17:
(7*3)+(6*5)+(5*9)+(4*7)+(3*3)+(2*1)+(1*7)=142
142 % 10 = 2
So 35973-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrNO3/c11-7-3-1-2-5-8(7)12-4-6(9(5)13)10(14)15/h1-4H,(H,12,13)(H,14,15)
