35978-75-7

Usage

Uses

Used in Peptide Synthesis:
AC-ALA-PNA is used as a building block for peptide synthesis, facilitating the creation of peptide nucleic acid complexes. Its incorporation of the protective AC group and PNA component allows for the development of stable and specific molecular structures.
Used in Molecular Probes for Biological Research:
AC-ALA-PNA is utilized as a component in molecular probes, enabling researchers to study various biological processes and mechanisms. Its ability to bind to specific nucleotide sequences makes it a valuable tool for investigating gene expression and genetic disorders.
Used in Diagnostic Applications:
In the field of diagnostics, AC-ALA-PNA serves as a crucial component in the development of tests and assays that detect and analyze genetic material. Its specificity and stability contribute to the accuracy and reliability of diagnostic tools.
Used in Gene Expression Studies:
AC-ALA-PNA is employed in the study of gene expression, providing insights into the regulation and function of genes. Its interaction with nucleotide sequences allows researchers to explore the molecular mechanisms underlying gene expression.
Used in Genetic Disorders Research:
In the investigation of genetic disorders, AC-ALA-PNA plays a significant role in understanding the molecular basis of these conditions. Its ability to bind to specific DNA sequences aids in the identification of genetic mutations and the development of targeted therapies.
Overall, AC-ALA-PNA is a versatile and essential compound in the field of molecular biology, with applications spanning from peptide synthesis to diagnostics and genetic research. Its unique properties and utility make it a valuable asset in advancing our understanding of biological systems and developing new therapeutic approaches.

InChI:InChI=1/C11H13N3O4/c1-7(12-8(2)15)11(16)13-9-3-5-10(6-4-9)14(17)18/h3-7H,1-2H3,(H,12,15)(H,13,16)/t7-/m0/s1