3605-65-0 Usage
Uses
Used in Chemical Catalysts:
(2-BUTANOLATO)BIS(2-PROPANOLATO)ALUMINIUM is used as a catalyst to facilitate various organic reactions, such as polymerization and esterification, due to its ability to promote the formation of carbon-carbon bonds and the conversion of alcohols to their corresponding esters.
Used in Plastics Production:
In the plastics industry, (2-BUTANOLATO)BIS(2-PROPANOLATO)ALUMINIUM is used as a catalyst to aid in the synthesis of polymers, contributing to the development of materials with specific properties for various applications.
Used in Resin Production:
(2-BUTANOLATO)BIS(2-PROPANOLATO)ALUMINIUM is utilized in the production of resins, where its catalytic properties help in the formation of complex polymeric structures that are essential for coatings, adhesives, and composite materials.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, (2-BUTANOLATO)BIS(2-PROPANOLATO)ALUMINIUM is employed as a catalyst in the synthesis of various organic compounds, including active pharmaceutical ingredients, due to its ability to promote key reactions in the production process.
Used in Research and Development:
(2-BUTANOLATO)BIS(2-PROPANOLATO)ALUMINIUM is used in research settings for the synthesis of new organic compounds and the exploration of novel reaction pathways, furthering the understanding of organic chemistry and its applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3605-65-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,0 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3605-65:
(6*3)+(5*6)+(4*0)+(3*5)+(2*6)+(1*5)=80
80 % 10 = 0
So 3605-65-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H10O.2C3H8O.Al/c1-3-4(2)5;2*1-3(2)4;/h4-5H,3H2,1-2H3;2*3-4H,1-2H3;
