36052-37-6 Usage
General Description
Alpinetin is a natural flavonoid compound found in various plant species, including Alpinia katsumadai. It has been studied for its potential biological activities, including antioxidant, anti-inflammatory, anti-cancer, and neuroprotective effects. Alpinetin has shown promise in inhibiting the growth and spread of cancer cells by inducing apoptosis and inhibiting angiogenesis. Additionally, it has been investigated for its potential use in supporting cognitive function and protecting against neurodegenerative diseases. Its anti-inflammatory properties have also been explored for potential applications in treating inflammatory conditions. Overall, alpinetin is a compound of interest for its potential therapeutic effects in various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 36052-37-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,0,5 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36052-37:
(7*3)+(6*6)+(5*0)+(4*5)+(3*2)+(2*3)+(1*7)=96
96 % 10 = 6
So 36052-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O4/c1-19-14-7-11(17)8-15-16(14)12(18)9-13(20-15)10-5-3-2-4-6-10/h2-8,13,17H,9H2,1H3
