360573-13-3 Usage
General Description
3-(1H-Indol-3-yl)-2-[(5-methyl-furan-2-carbonyl)-amino]-propionic acid is a chemical compound with a complex structure. It consists of an indole group attached to a propionic acid chain, with a furan carbonyl amino group added to the propionic acid. 3-(1H-INDOL-3-YL)-2-[(5-METHYL-FURAN-2-CARBONYL)-AMINO]-PROPIONIC ACID is a derivative of indole, a heterocyclic aromatic organic compound, and can be used in various pharmaceutical and chemical applications. It may have potential use as a drug or in the synthesis of other complex organic compounds due to its unique structure and functional groups. Further research and studies may be needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 360573-13-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,0,5,7 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 360573-13:
(8*3)+(7*6)+(6*0)+(5*5)+(4*7)+(3*3)+(2*1)+(1*3)=133
133 % 10 = 3
So 360573-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O4/c1-10-6-7-15(23-10)16(20)19-14(17(21)22)8-11-9-18-13-5-3-2-4-12(11)13/h2-7,9,14,18H,8H2,1H3,(H,19,20)(H,21,22)/p-1/t14-/m1/s1