360575-29-7 Usage
General Description
4-Bromo-benzo[b]thiophene-2-carboxylic acid methyl ester is a chemical compound that features a benzo[b]thiophene ring - a heterocyclic compound containing two fused rings, one of which is a benzene ring and the other a thiophene ring. It also contains a bromine atom attached to the benzene ring, and a carboxylic acid methyl ester group attached to the thiophene ring. 4-BROMO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER is often used in the synthesis of various other organic compounds, particularly in pharmaceutical chemistry. Its molecular formula is C10H7BrO2S. Properties such as its melting point, boiling point and solubility depend on its exact structure but it is usually observed as a crystalline solid. Given its structure, it is likely to have a strong aromatic smell and is likely to be toxic if ingested or inhaled.
Check Digit Verification of cas no
The CAS Registry Mumber 360575-29-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,0,5,7 and 5 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 360575-29:
(8*3)+(7*6)+(6*0)+(5*5)+(4*7)+(3*5)+(2*2)+(1*9)=147
147 % 10 = 7
So 360575-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7BrO2S/c1-13-10(12)9-5-6-7(11)3-2-4-8(6)14-9/h2-5H,1H3
